About Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate
Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate (PubChem CID 175002644) has the molecular formula C20H25NO2
and a molecular weight of 311.40 g/mol. Its IUPAC name is ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate.
Molecular Properties
| Compound Name | Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate |
| PubChem CID | 175002644 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate |
| SMILES | CCOC(=O)CC(C1=CC(=CC(=C1)C2=C(C=CC=C2C)C)C)N |
| InChI | InChI=1S/C20H25NO2/c1-5-23-19(22)12-18(21)16-9-13(2)10-17(11-16)20-14(3)7-6-8-15(20)4/h6-11,18H,5,12,21H2,1-4H3 |
| InChIKey | ADOJAXKGEMPPCD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | 374 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate?
The IUPAC name of Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate (CID 175002644) is ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate.
What is the SMILES notation for Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate?
The canonical SMILES for Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate is CCOC(=O)CC(C1=CC(=CC(=C1)C2=C(C=CC=C2C)C)C)N.
What is the InChIKey of Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate?
The InChIKey is ADOJAXKGEMPPCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO2/c1-5-23-19(22)12-18(21)16-9-13(2)10-17(11-16)20-14(3)7-6-8-15(20)4/h6-11,18H,5,12,21H2,1-4H3.
What are the key properties of Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate?
Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate has a molecular weight of 311.40 g/mol, XLogP of 3.70, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ethyl 3-amino-3-[3-(2,6-dimethylphenyl)-5-methylphenyl]propanoate is sourced from PubChem (CID 175002644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).