C46H26N4 — CID 176917660
2-[2-(3-cyanophenyl)-4,5-bis(4-cyanophenyl)-3,6-diphenylphenyl]benzonitrile (PubChem CID 176917660) has the molecular formula C46H26N4 and a molecular weight of 634.74 g/mol. Its IUPAC name is 2-[2-(3-cyanophenyl)-4,5-bis(4-cyanophenyl)-3,6-diphenylphenyl]benzonitrile.
| Compound Name | 2-[2-(3-cyanophenyl)-4,5-bis(4-cyanophenyl)-3,6-diphenylphenyl]benzonitrile |
|---|---|
| PubChem CID | 176917660 |
| Molecular Formula | C46H26N4 |
| Molecular Weight | 634.74 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 2-[2-(3-cyanophenyl)-4,5-bis(4-cyanophenyl)-3,6-diphenylphenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2c(-c3ccc(C#N)cc3)c(-c3ccccc3)c(-c3ccccc3C#N)c(-c3cccc(C#N)c3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H26N4/c47-27-31-18-22-36(23-19-31)42-41(34-11-3-1-4-12-34)45(38-16-9-10-33(26-38)29-49)46(40-17-8-7-15-39(40)30-50)44(35-13-5-2-6-14-35)43(42)37-24-20-32(28-48)21-25-37/h1-26H |
| InChIKey | ZWDQLUVIENMPOO-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.74 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |