C15H9F2N5O — CID 25226404
2,4-diamino-5,8-difluoro-7-phenoxyquinazoline-6-carbonitrile (PubChem CID 25226404) has the molecular formula C15H9F2N5O and a molecular weight of 313.27 g/mol. Its IUPAC name is 2,4-diamino-5,8-difluoro-7-phenoxyquinazoline-6-carbonitrile.
| Compound Name | 2,4-diamino-5,8-difluoro-7-phenoxyquinazoline-6-carbonitrile |
|---|---|
| PubChem CID | 25226404 |
| Molecular Formula | C15H9F2N5O |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2,4-diamino-5,8-difluoro-7-phenoxyquinazoline-6-carbonitrile |
| SMILES | N#Cc1c(Oc2ccccc2)c(F)c2nc(N)nc(N)c2c1F |
| InChI | InChI=1S/C15H9F2N5O/c16-10-8(6-18)13(23-7-4-2-1-3-5-7)11(17)12-9(10)14(19)22-15(20)21-12/h1-5H,(H4,19,20,21,22) |
| InChIKey | GUZBOKBMVWWKEJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 110.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |