C9H9N5O — CID 154264389
5-phenoxytriazine-4,6-diamine (PubChem CID 154264389) has the molecular formula C9H9N5O and a molecular weight of 203.21 g/mol. Its IUPAC name is 5-phenoxytriazine-4,6-diamine.
| Compound Name | 5-phenoxytriazine-4,6-diamine |
|---|---|
| PubChem CID | 154264389 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 5-phenoxytriazine-4,6-diamine |
| SMILES | Nc1nnnc(N)c1Oc1ccccc1 |
| InChI | InChI=1S/C9H9N5O/c10-8-7(9(11)13-14-12-8)15-6-4-2-1-3-5-6/h1-5H,(H4,10,11,12,13) |
| InChIKey | LDPNNQIPGNCXBT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |