C11H11N3O — CID 21485976
5-phenoxypyridine-2,3-diamine (PubChem CID 21485976) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-phenoxypyridine-2,3-diamine.
| Compound Name | 5-phenoxypyridine-2,3-diamine |
|---|---|
| PubChem CID | 21485976 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-phenoxypyridine-2,3-diamine |
| SMILES | Nc1cc(Oc2ccccc2)cnc1N |
| InChI | InChI=1S/C11H11N3O/c12-10-6-9(7-14-11(10)13)15-8-4-2-1-3-5-8/h1-7H,12H2,(H2,13,14) |
| InChIKey | BQQQOCJYFSJJMO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |