About 5-phenoxypyridine-2,3-diamine
5-phenoxypyridine-2,3-diamine (PubChem CID 21485976) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-phenoxypyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-phenoxypyridine-2,3-diamine |
| PubChem CID | 21485976 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 5-phenoxypyridine-2,3-diamine |
| SMILES | Nc1cc(Oc2ccccc2)cnc1N |
| InChI | InChI=1S/C11H11N3O/c12-10-6-9(7-14-11(10)13)15-8-4-2-1-3-5-8/h1-7H,12H2,(H2,13,14) |
| InChIKey | BQQQOCJYFSJJMO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenoxypyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenoxypyridine-2,3-diamine?
The IUPAC name of 5-phenoxypyridine-2,3-diamine (CID 21485976) is 5-phenoxypyridine-2,3-diamine.
What is the SMILES notation for 5-phenoxypyridine-2,3-diamine?
The canonical SMILES for 5-phenoxypyridine-2,3-diamine is Nc1cc(Oc2ccccc2)cnc1N.
What is the InChIKey of 5-phenoxypyridine-2,3-diamine?
The InChIKey is BQQQOCJYFSJJMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c12-10-6-9(7-14-11(10)13)15-8-4-2-1-3-5-8/h1-7H,12H2,(H2,13,14).
What are the key properties of 5-phenoxypyridine-2,3-diamine?
5-phenoxypyridine-2,3-diamine has a molecular weight of 201.23 g/mol, XLogP of 2.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenoxypyridine-2,3-diamine is sourced from PubChem (CID 21485976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).