C18H14F3N3O — CID 28847148
3-N-(4-phenoxyphenyl)-5-(trifluoromethyl)pyridine-2,3-diamine (PubChem CID 28847148) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is 3-N-(4-phenoxyphenyl)-5-(trifluoromethyl)pyridine-2,3-diamine.
| Compound Name | 3-N-(4-phenoxyphenyl)-5-(trifluoromethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 28847148 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-N-(4-phenoxyphenyl)-5-(trifluoromethyl)pyridine-2,3-diamine |
| SMILES | Nc1ncc(C(F)(F)F)cc1Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H14F3N3O/c19-18(20,21)12-10-16(17(22)23-11-12)24-13-6-8-15(9-7-13)25-14-4-2-1-3-5-14/h1-11,24H,(H2,22,23) |
| InChIKey | VMWBJJAERMAFMT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |