About 4-(2-bromophenoxy)-5,6-diphenoxytriazine
4-(2-bromophenoxy)-5,6-diphenoxytriazine (PubChem CID 141160537) has the molecular formula C21H14BrN3O3
and a molecular weight of 436.27 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-5,6-diphenoxytriazine.
Molecular Properties
| Compound Name | 4-(2-bromophenoxy)-5,6-diphenoxytriazine |
| PubChem CID | 141160537 |
| Molecular Formula | C21H14BrN3O3 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | 4-(2-bromophenoxy)-5,6-diphenoxytriazine |
| SMILES | Brc1ccccc1Oc1nnnc(Oc2ccccc2)c1Oc1ccccc1 |
| InChI | InChI=1S/C21H14BrN3O3/c22-17-13-7-8-14-18(17)28-21-19(26-15-9-3-1-4-10-15)20(23-25-24-21)27-16-11-5-2-6-12-16/h1-14H |
| InChIKey | ZIWQUFAUOLNSEX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-bromophenoxy)-5,6-diphenoxytriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromophenoxy)-5,6-diphenoxytriazine?
The IUPAC name of 4-(2-bromophenoxy)-5,6-diphenoxytriazine (CID 141160537) is 4-(2-bromophenoxy)-5,6-diphenoxytriazine.
What is the SMILES notation for 4-(2-bromophenoxy)-5,6-diphenoxytriazine?
The canonical SMILES for 4-(2-bromophenoxy)-5,6-diphenoxytriazine is Brc1ccccc1Oc1nnnc(Oc2ccccc2)c1Oc1ccccc1.
What is the InChIKey of 4-(2-bromophenoxy)-5,6-diphenoxytriazine?
The InChIKey is ZIWQUFAUOLNSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14BrN3O3/c22-17-13-7-8-14-18(17)28-21-19(26-15-9-3-1-4-10-15)20(23-25-24-21)27-16-11-5-2-6-12-16/h1-14H.
What are the key properties of 4-(2-bromophenoxy)-5,6-diphenoxytriazine?
4-(2-bromophenoxy)-5,6-diphenoxytriazine has a molecular weight of 436.27 g/mol, XLogP of 6.01, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromophenoxy)-5,6-diphenoxytriazine is sourced from PubChem (CID 141160537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).