C15H9F2N3O — CID 139814017
4-anilino-3,6-difluoro-5-methoxybenzene-1,2-dicarbonitrile (PubChem CID 139814017) has the molecular formula C15H9F2N3O and a molecular weight of 285.25 g/mol. Its IUPAC name is 4-anilino-3,6-difluoro-5-methoxybenzene-1,2-dicarbonitrile.
| Compound Name | 4-anilino-3,6-difluoro-5-methoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139814017 |
| Molecular Formula | C15H9F2N3O |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-anilino-3,6-difluoro-5-methoxybenzene-1,2-dicarbonitrile |
| SMILES | COc1c(F)c(C#N)c(C#N)c(F)c1Nc1ccccc1 |
| InChI | InChI=1S/C15H9F2N3O/c1-21-15-13(17)11(8-19)10(7-18)12(16)14(15)20-9-5-3-2-4-6-9/h2-6,20H,1H3 |
| InChIKey | AVNKJJTWBNOLNK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |