C19H17F2N3OS — CID 139814099
4-butylsulfanyl-3,6-difluoro-5-(3-methoxyanilino)benzene-1,2-dicarbonitrile (PubChem CID 139814099) has the molecular formula C19H17F2N3OS and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-butylsulfanyl-3,6-difluoro-5-(3-methoxyanilino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-butylsulfanyl-3,6-difluoro-5-(3-methoxyanilino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139814099 |
| Molecular Formula | C19H17F2N3OS |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-butylsulfanyl-3,6-difluoro-5-(3-methoxyanilino)benzene-1,2-dicarbonitrile |
| SMILES | CCCCSc1c(F)c(C#N)c(C#N)c(F)c1Nc1cccc(OC)c1 |
| InChI | InChI=1S/C19H17F2N3OS/c1-3-4-8-26-19-17(21)15(11-23)14(10-22)16(20)18(19)24-12-6-5-7-13(9-12)25-2/h5-7,9,24H,3-4,8H2,1-2H3 |
| InChIKey | VNJLZVXEAVJKTM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|