C16H17F3N2S — CID 135071452
3,4,6-trifluoro-5-octylsulfanylbenzene-1,2-dicarbonitrile (PubChem CID 135071452) has the molecular formula C16H17F3N2S and a molecular weight of 326.39 g/mol. Its IUPAC name is 3,4,6-trifluoro-5-octylsulfanylbenzene-1,2-dicarbonitrile.
| Compound Name | 3,4,6-trifluoro-5-octylsulfanylbenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 135071452 |
| Molecular Formula | C16H17F3N2S |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 3,4,6-trifluoro-5-octylsulfanylbenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCCSc1c(F)c(F)c(C#N)c(C#N)c1F |
| InChI | InChI=1S/C16H17F3N2S/c1-2-3-4-5-6-7-8-22-16-14(18)12(10-21)11(9-20)13(17)15(16)19/h2-8H2,1H3 |
| InChIKey | RWJYDCCXFQXDDB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|