C18H26F4S — CID 58436006
3-dodecylsulfanyl-1,2,4,5-tetrafluorobenzene (PubChem CID 58436006) has the molecular formula C18H26F4S and a molecular weight of 350.47 g/mol. Its IUPAC name is 3-dodecylsulfanyl-1,2,4,5-tetrafluorobenzene.
| Compound Name | 3-dodecylsulfanyl-1,2,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 58436006 |
| Molecular Formula | C18H26F4S |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-dodecylsulfanyl-1,2,4,5-tetrafluorobenzene |
| SMILES | CCCCCCCCCCCCSc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C18H26F4S/c1-2-3-4-5-6-7-8-9-10-11-12-23-18-16(21)14(19)13-15(20)17(18)22/h13H,2-12H2,1H3 |
| InChIKey | OMTFQUQECJEDAO-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|