C40H44BF8S4- — CID 59545105
tetrakis(4-butylsulfanyl-3,5-difluorophenyl)boranuide (PubChem CID 59545105) has the molecular formula C40H44BF8S4- and a molecular weight of 815.86 g/mol. Its IUPAC name is tetrakis(4-butylsulfanyl-3,5-difluorophenyl)boranuide.
| Compound Name | tetrakis(4-butylsulfanyl-3,5-difluorophenyl)boranuide |
|---|---|
| PubChem CID | 59545105 |
| Molecular Formula | C40H44BF8S4- |
| Molecular Weight | 815.86 g/mol |
| Exact Mass | 815.23 |
| IUPAC Name | tetrakis(4-butylsulfanyl-3,5-difluorophenyl)boranuide |
| SMILES | CCCCSc1c(F)cc([B-](c2cc(F)c(SCCCC)c(F)c2)(c2cc(F)c(SCCCC)c(F)c2)c2cc(F)c(SCCCC)c(F)c2)cc1F |
| InChI | InChI=1S/C40H44BF8S4/c1-5-9-13-50-37-29(42)17-25(18-30(37)43)41(26-19-31(44)38(32(45)20-26)51-14-10-6-2,27-21-33(46)39(34(47)22-27)52-15-11-7-3)28-23-35(48)40(36(49)24-28)53-16-12-8-4/h17-24H,5-16H2,1-4H3/q-1 |
| InChIKey | FHFIVGDKRXNRPJ-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.86 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|