C10H11F3S — CID 142501810
2-butylsulfanyl-1,3,5-trifluorobenzene (PubChem CID 142501810) has the molecular formula C10H11F3S and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-butylsulfanyl-1,3,5-trifluorobenzene.
| Compound Name | 2-butylsulfanyl-1,3,5-trifluorobenzene |
|---|---|
| PubChem CID | 142501810 |
| Molecular Formula | C10H11F3S |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-butylsulfanyl-1,3,5-trifluorobenzene |
| SMILES | CCCCSc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H11F3S/c1-2-3-4-14-10-8(12)5-7(11)6-9(10)13/h5-6H,2-4H2,1H3 |
| InChIKey | JULQKIXSRIUNLB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|