About 2-butylsulfanyl-1,3,5-trifluorobenzene
2-butylsulfanyl-1,3,5-trifluorobenzene (PubChem CID 142501810) has the molecular formula C10H11F3S
and a molecular weight of 220.26 g/mol. Its IUPAC name is 2-butylsulfanyl-1,3,5-trifluorobenzene.
Molecular Properties
| Compound Name | 2-butylsulfanyl-1,3,5-trifluorobenzene |
| PubChem CID | 142501810 |
| Molecular Formula | C10H11F3S |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-butylsulfanyl-1,3,5-trifluorobenzene |
| SMILES | CCCCSc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H11F3S/c1-2-3-4-14-10-8(12)5-7(11)6-9(10)13/h5-6H,2-4H2,1H3 |
| InChIKey | JULQKIXSRIUNLB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butylsulfanyl-1,3,5-trifluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfanyl-1,3,5-trifluorobenzene?
The IUPAC name of 2-butylsulfanyl-1,3,5-trifluorobenzene (CID 142501810) is 2-butylsulfanyl-1,3,5-trifluorobenzene.
What is the SMILES notation for 2-butylsulfanyl-1,3,5-trifluorobenzene?
The canonical SMILES for 2-butylsulfanyl-1,3,5-trifluorobenzene is CCCCSc1c(F)cc(F)cc1F.
What is the InChIKey of 2-butylsulfanyl-1,3,5-trifluorobenzene?
The InChIKey is JULQKIXSRIUNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3S/c1-2-3-4-14-10-8(12)5-7(11)6-9(10)13/h5-6H,2-4H2,1H3.
What are the key properties of 2-butylsulfanyl-1,3,5-trifluorobenzene?
2-butylsulfanyl-1,3,5-trifluorobenzene has a molecular weight of 220.26 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfanyl-1,3,5-trifluorobenzene is sourced from PubChem (CID 142501810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).