C11H13F4NS — CID 19433014
(4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methanamine (PubChem CID 19433014) has the molecular formula C11H13F4NS and a molecular weight of 267.29 g/mol. Its IUPAC name is (4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methanamine.
| Compound Name | (4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methanamine |
|---|---|
| PubChem CID | 19433014 |
| Molecular Formula | C11H13F4NS |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (4-butylsulfanyl-2,3,5,6-tetrafluorophenyl)methanamine |
| SMILES | CCCCSc1c(F)c(F)c(CN)c(F)c1F |
| InChI | InChI=1S/C11H13F4NS/c1-2-3-4-17-11-9(14)7(12)6(5-16)8(13)10(11)15/h2-5,16H2,1H3 |
| InChIKey | XCZJSUPXMAPCRH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|