C11H14F5N — CID 175415233
butane;(2,3,4,5,6-pentafluorophenyl)methanamine (PubChem CID 175415233) has the molecular formula C11H14F5N and a molecular weight of 255.23 g/mol. Its IUPAC name is butane;(2,3,4,5,6-pentafluorophenyl)methanamine.
| Compound Name | butane;(2,3,4,5,6-pentafluorophenyl)methanamine |
|---|---|
| PubChem CID | 175415233 |
| Molecular Formula | C11H14F5N |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | butane;(2,3,4,5,6-pentafluorophenyl)methanamine |
| SMILES | CCCC.NCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7H4F5N.C4H10/c8-3-2(1-13)4(9)6(11)7(12)5(3)10;1-3-4-2/h1,13H2;3-4H2,1-2H3 |
| InChIKey | GDSJCRLOFBBQDH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|