C7H4Cl2F3N — CID 119000719
(2,4-dichloro-3,5,6-trifluorophenyl)methanamine (PubChem CID 119000719) has the molecular formula C7H4Cl2F3N and a molecular weight of 230.02 g/mol. Its IUPAC name is (2,4-dichloro-3,5,6-trifluorophenyl)methanamine.
| Compound Name | (2,4-dichloro-3,5,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 119000719 |
| Molecular Formula | C7H4Cl2F3N |
| Molecular Weight | 230.02 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | (2,4-dichloro-3,5,6-trifluorophenyl)methanamine |
| SMILES | NCc1c(F)c(F)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C7H4Cl2F3N/c8-3-2(1-13)5(10)7(12)4(9)6(3)11/h1,13H2 |
| InChIKey | HLAJRSJODQEPNH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.02 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|