C12H15F4N — CID 19433002
(2,3,5,6-tetrafluoro-4-pentylphenyl)methanamine (PubChem CID 19433002) has the molecular formula C12H15F4N and a molecular weight of 249.25 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-pentylphenyl)methanamine.
| Compound Name | (2,3,5,6-tetrafluoro-4-pentylphenyl)methanamine |
|---|---|
| PubChem CID | 19433002 |
| Molecular Formula | C12H15F4N |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-pentylphenyl)methanamine |
| SMILES | CCCCCc1c(F)c(F)c(CN)c(F)c1F |
| InChI | InChI=1S/C12H15F4N/c1-2-3-4-5-7-9(13)11(15)8(6-17)12(16)10(7)14/h2-6,17H2,1H3 |
| InChIKey | FPYJGJDJJBQQAL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|