C16H26S — CID 10777103
3-hexylsulfanyl-1,2,4,5-tetramethylbenzene (PubChem CID 10777103) has the molecular formula C16H26S and a molecular weight of 250.45 g/mol. Its IUPAC name is 3-hexylsulfanyl-1,2,4,5-tetramethylbenzene.
| Compound Name | 3-hexylsulfanyl-1,2,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 10777103 |
| Molecular Formula | C16H26S |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 3-hexylsulfanyl-1,2,4,5-tetramethylbenzene |
| SMILES | CCCCCCSc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C16H26S/c1-6-7-8-9-10-17-16-14(4)12(2)11-13(3)15(16)5/h11H,6-10H2,1-5H3 |
| InChIKey | XWDBVWHSNGJYJJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|