C18H16N2O4 — CID 2824412
3,4-bis(3-methoxyanilino)cyclobut-3-ene-1,2-dione (PubChem CID 2824412) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3,4-bis(3-methoxyanilino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis(3-methoxyanilino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 2824412 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3,4-bis(3-methoxyanilino)cyclobut-3-ene-1,2-dione |
| SMILES | COc1cccc(Nc2c(Nc3cccc(OC)c3)c(=O)c2=O)c1 |
| InChI | InChI=1S/C18H16N2O4/c1-23-13-7-3-5-11(9-13)19-15-16(18(22)17(15)21)20-12-6-4-8-14(10-12)24-2/h3-10,19-20H,1-2H3 |
| InChIKey | VQTMXGBNBYBMOF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|