C12H12N2O3 — CID 135173403
3-(3-methoxyanilino)-4-(methylamino)cyclobut-3-ene-1,2-dione (PubChem CID 135173403) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3-(3-methoxyanilino)-4-(methylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-methoxyanilino)-4-(methylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 135173403 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-(3-methoxyanilino)-4-(methylamino)cyclobut-3-ene-1,2-dione |
| SMILES | CNc1c(Nc2cccc(OC)c2)c(=O)c1=O |
| InChI | InChI=1S/C12H12N2O3/c1-13-9-10(12(16)11(9)15)14-7-4-3-5-8(6-7)17-2/h3-6,13-14H,1-2H3 |
| InChIKey | PSDGBTICSXWMGG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|