C11H6F2N2O3 — CID 139844769
2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid (PubChem CID 139844769) has the molecular formula C11H6F2N2O3 and a molecular weight of 252.18 g/mol. Its IUPAC name is 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid.
| Compound Name | 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 139844769 |
| Molecular Formula | C11H6F2N2O3 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid |
| SMILES | COc1c(F)c(C#N)c(C#N)c(F)c1CC(=O)O |
| InChI | InChI=1S/C11H6F2N2O3/c1-18-11-5(2-8(16)17)9(12)6(3-14)7(4-15)10(11)13/h2H2,1H3,(H,16,17) |
| InChIKey | IVLKCKKTPDTFPJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |