2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid

C11H6F2N2O3 — CID 139844769

IUPAC2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid
SMILESCOc1c(F)c(C#N)c(C#N)c(F)c1CC(=O)O
InChIInChI=1S/C11H6F2N2O3/c1-18-11-5(2-8(16)17)9(12)6(3-14)7(4-15)10(11)13/h2H2,1H3,(H,16,17)
InChIKeyIVLKCKKTPDTFPJ-UHFFFAOYSA-N
MW252.18 g/mol
LogP1.34
Rot. Bonds3

About 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid

2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid (PubChem CID 139844769) has the molecular formula C11H6F2N2O3 and a molecular weight of 252.18 g/mol. Its IUPAC name is 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid.

Molecular Properties

Compound Name2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid
PubChem CID139844769
Molecular FormulaC11H6F2N2O3
Molecular Weight252.18 g/mol
Exact Mass252.03
IUPAC Name2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid
SMILESCOc1c(F)c(C#N)c(C#N)c(F)c1CC(=O)O
InChIInChI=1S/C11H6F2N2O3/c1-18-11-5(2-8(16)17)9(12)6(3-14)7(4-15)10(11)13/h2H2,1H3,(H,16,17)
InChIKeyIVLKCKKTPDTFPJ-UHFFFAOYSA-N
XLogP1.34
TPSA94.11 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.18
LogP ≤ 51.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid?
The IUPAC name of 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid (CID 139844769) is 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid.
What is the SMILES notation for 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid?
The canonical SMILES for 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid is COc1c(F)c(C#N)c(C#N)c(F)c1CC(=O)O.
What is the InChIKey of 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid?
The InChIKey is IVLKCKKTPDTFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N2O3/c1-18-11-5(2-8(16)17)9(12)6(3-14)7(4-15)10(11)13/h2H2,1H3,(H,16,17).
What are the key properties of 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid?
2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid has a molecular weight of 252.18 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dicyano-2,5-difluoro-6-methoxyphenyl)acetic acid is sourced from PubChem (CID 139844769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).