C10H7F2NO3 — CID 164945972
4-cyano-2,5-difluoro-3-methoxy-6-methylbenzoic acid (PubChem CID 164945972) has the molecular formula C10H7F2NO3 and a molecular weight of 227.17 g/mol. Its IUPAC name is 4-cyano-2,5-difluoro-3-methoxy-6-methylbenzoic acid.
| Compound Name | 4-cyano-2,5-difluoro-3-methoxy-6-methylbenzoic acid |
|---|---|
| PubChem CID | 164945972 |
| Molecular Formula | C10H7F2NO3 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 4-cyano-2,5-difluoro-3-methoxy-6-methylbenzoic acid |
| SMILES | COc1c(F)c(C(=O)O)c(C)c(F)c1C#N |
| InChI | InChI=1S/C10H7F2NO3/c1-4-6(10(14)15)8(12)9(16-2)5(3-13)7(4)11/h1-2H3,(H,14,15) |
| InChIKey | BVBKXNRGRWHQOS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |