C10H3F2N3 — CID 167515087
2,4-difluoro-6-methylbenzene-1,3,5-tricarbonitrile (PubChem CID 167515087) has the molecular formula C10H3F2N3 and a molecular weight of 203.15 g/mol. Its IUPAC name is 2,4-difluoro-6-methylbenzene-1,3,5-tricarbonitrile.
| Compound Name | 2,4-difluoro-6-methylbenzene-1,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 167515087 |
| Molecular Formula | C10H3F2N3 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2,4-difluoro-6-methylbenzene-1,3,5-tricarbonitrile |
| SMILES | Cc1c(C#N)c(F)c(C#N)c(F)c1C#N |
| InChI | InChI=1S/C10H3F2N3/c1-5-6(2-13)9(11)8(4-15)10(12)7(5)3-14/h1H3 |
| InChIKey | YGQKSQNIUYDGJI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |