About 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile
3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile (PubChem CID 167515078) has the molecular formula C8H3F2N3
and a molecular weight of 179.13 g/mol. Its IUPAC name is 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile.
Molecular Properties
| Compound Name | 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile |
| PubChem CID | 167515078 |
| Molecular Formula | C8H3F2N3 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile |
| SMILES | Cc1c(F)c(C#N)nc(C#N)c1F |
| InChI | InChI=1S/C8H3F2N3/c1-4-7(9)5(2-11)13-6(3-12)8(4)10/h1H3 |
| InChIKey | GVPGBKVTXCAVET-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile?
The IUPAC name of 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile (CID 167515078) is 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile.
What is the SMILES notation for 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile?
The canonical SMILES for 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile is Cc1c(F)c(C#N)nc(C#N)c1F.
What is the InChIKey of 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile?
The InChIKey is GVPGBKVTXCAVET-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3F2N3/c1-4-7(9)5(2-11)13-6(3-12)8(4)10/h1H3.
What are the key properties of 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile?
3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile has a molecular weight of 179.13 g/mol, XLogP of 1.41, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-methylpyridine-2,6-dicarbonitrile is sourced from PubChem (CID 167515078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).