C8H5F3N2O — CID 174754004
6-ethoxy-3,4,5-trifluoropyridine-2-carbonitrile (PubChem CID 174754004) has the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. Its IUPAC name is 6-ethoxy-3,4,5-trifluoropyridine-2-carbonitrile.
| Compound Name | 6-ethoxy-3,4,5-trifluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 174754004 |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 6-ethoxy-3,4,5-trifluoropyridine-2-carbonitrile |
| SMILES | CCOc1nc(C#N)c(F)c(F)c1F |
| InChI | InChI=1S/C8H5F3N2O/c1-2-14-8-7(11)6(10)5(9)4(3-12)13-8/h2H2,1H3 |
| InChIKey | DCNWMEQCCXDFFE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |