C7H6F3NO — CID 173151016
2-ethoxy-3,4,6-trifluoropyridine (PubChem CID 173151016) has the molecular formula C7H6F3NO and a molecular weight of 177.12 g/mol. Its IUPAC name is 2-ethoxy-3,4,6-trifluoropyridine.
| Compound Name | 2-ethoxy-3,4,6-trifluoropyridine |
|---|---|
| PubChem CID | 173151016 |
| Molecular Formula | C7H6F3NO |
| Molecular Weight | 177.12 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 2-ethoxy-3,4,6-trifluoropyridine |
| SMILES | CCOc1nc(F)cc(F)c1F |
| InChI | InChI=1S/C7H6F3NO/c1-2-12-7-6(10)4(8)3-5(9)11-7/h3H,2H2,1H3 |
| InChIKey | BBLXVIAVIZPQFI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.12 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|