C10H5F3N2O — CID 19352145
4-ethoxy-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 19352145) has the molecular formula C10H5F3N2O and a molecular weight of 226.16 g/mol. Its IUPAC name is 4-ethoxy-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
| Compound Name | 4-ethoxy-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 19352145 |
| Molecular Formula | C10H5F3N2O |
| Molecular Weight | 226.16 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-ethoxy-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | CCOc1c(F)c(F)c(C#N)c(C#N)c1F |
| InChI | InChI=1S/C10H5F3N2O/c1-2-16-10-8(12)6(4-15)5(3-14)7(11)9(10)13/h2H2,1H3 |
| InChIKey | FRROWDWGLTYWIR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|