C8H2F3N3 — CID 121407411
4-(cyanomethyl)-3,5,6-trifluoropyridine-2-carbonitrile (PubChem CID 121407411) has the molecular formula C8H2F3N3 and a molecular weight of 197.12 g/mol. Its IUPAC name is 4-(cyanomethyl)-3,5,6-trifluoropyridine-2-carbonitrile.
| Compound Name | 4-(cyanomethyl)-3,5,6-trifluoropyridine-2-carbonitrile |
|---|---|
| PubChem CID | 121407411 |
| Molecular Formula | C8H2F3N3 |
| Molecular Weight | 197.12 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 4-(cyanomethyl)-3,5,6-trifluoropyridine-2-carbonitrile |
| SMILES | N#CCc1c(F)c(F)nc(C#N)c1F |
| InChI | InChI=1S/C8H2F3N3/c9-6-4(1-2-12)7(10)8(11)14-5(6)3-13/h1H2 |
| InChIKey | YDQUBLDWKDOELD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.12 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|