C9H4F2N2 — CID 118821709
4-(cyanomethyl)-3,5-difluorobenzonitrile (PubChem CID 118821709) has the molecular formula C9H4F2N2 and a molecular weight of 178.14 g/mol. Its IUPAC name is 4-(cyanomethyl)-3,5-difluorobenzonitrile.
| Compound Name | 4-(cyanomethyl)-3,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 118821709 |
| Molecular Formula | C9H4F2N2 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 4-(cyanomethyl)-3,5-difluorobenzonitrile |
| SMILES | N#CCc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C9H4F2N2/c10-8-3-6(5-13)4-9(11)7(8)1-2-12/h3-4H,1H2 |
| InChIKey | BHZDFIHGPACJJC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |