C15H8Br3F4N — CID 160735694
5-bromo-2-(bromomethyl)-1,3-difluorobenzene;2-(4-bromo-2,6-difluorophenyl)acetonitrile (PubChem CID 160735694) has the molecular formula C15H8Br3F4N and a molecular weight of 517.94 g/mol. Its IUPAC name is 5-bromo-2-(bromomethyl)-1,3-difluorobenzene;2-(4-bromo-2,6-difluorophenyl)acetonitrile.
| Compound Name | 5-bromo-2-(bromomethyl)-1,3-difluorobenzene;2-(4-bromo-2,6-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 160735694 |
| Molecular Formula | C15H8Br3F4N |
| Molecular Weight | 517.94 g/mol |
| Exact Mass | 514.81 |
| IUPAC Name | 5-bromo-2-(bromomethyl)-1,3-difluorobenzene;2-(4-bromo-2,6-difluorophenyl)acetonitrile |
| SMILES | Fc1cc(Br)cc(F)c1CBr.N#CCc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C8H4BrF2N.C7H4Br2F2/c9-5-3-7(10)6(1-2-12)8(11)4-5;8-3-5-6(10)1-4(9)2-7(5)11/h3-4H,1H2;1-2H,3H2 |
| InChIKey | RUXNFBASSDTOST-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.94 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|