C8H4Br2FN — CID 2773983
2-(2,4-dibromo-6-fluorophenyl)acetonitrile (PubChem CID 2773983) has the molecular formula C8H4Br2FN and a molecular weight of 292.93 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-fluorophenyl)acetonitrile.
| Compound Name | 2-(2,4-dibromo-6-fluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 2773983 |
| Molecular Formula | C8H4Br2FN |
| Molecular Weight | 292.93 g/mol |
| Exact Mass | 290.87 |
| IUPAC Name | 2-(2,4-dibromo-6-fluorophenyl)acetonitrile |
| SMILES | N#CCc1c(F)cc(Br)cc1Br |
| InChI | InChI=1S/C8H4Br2FN/c9-5-3-7(10)6(1-2-12)8(11)4-5/h3-4H,1H2 |
| InChIKey | NHMWCEOJLLMZEJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |