C10H6Br2N2 — CID 153406802
2-[3,6-dibromo-2-(cyanomethyl)phenyl]acetonitrile (PubChem CID 153406802) has the molecular formula C10H6Br2N2 and a molecular weight of 313.98 g/mol. Its IUPAC name is 2-[3,6-dibromo-2-(cyanomethyl)phenyl]acetonitrile.
| Compound Name | 2-[3,6-dibromo-2-(cyanomethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 153406802 |
| Molecular Formula | C10H6Br2N2 |
| Molecular Weight | 313.98 g/mol |
| Exact Mass | 311.89 |
| IUPAC Name | 2-[3,6-dibromo-2-(cyanomethyl)phenyl]acetonitrile |
| SMILES | N#CCc1c(Br)ccc(Br)c1CC#N |
| InChI | InChI=1S/C10H6Br2N2/c11-9-1-2-10(12)8(4-6-14)7(9)3-5-13/h1-2H,3-4H2 |
| InChIKey | MYCRUFVQXHYQDE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.98 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |