About sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide
sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide (PubChem CID 175978714) has the molecular formula C10H7BrFN2NaO
and a molecular weight of 293.07 g/mol. Its IUPAC name is sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide.
Molecular Properties
| Compound Name | sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide |
| PubChem CID | 175978714 |
| Molecular Formula | C10H7BrFN2NaO |
| Molecular Weight | 293.07 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide |
| SMILES | COc1ccc(Br)c(CC#N)c1F.[C-]#N.[Na+] |
| InChI | InChI=1S/C9H7BrFNO.CN.Na/c1-13-8-3-2-7(10)6(4-5-12)9(8)11;1-2;/h2-3H,4H2,1H3;;/q;-1;+1 |
| InChIKey | MQFXLJFZONCEBE-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.07 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide?
The IUPAC name of sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide (CID 175978714) is sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide.
What is the SMILES notation for sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide?
The canonical SMILES for sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide is COc1ccc(Br)c(CC#N)c1F.[C-]#N.[Na+].
What is the InChIKey of sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide?
The InChIKey is MQFXLJFZONCEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrFNO.CN.Na/c1-13-8-3-2-7(10)6(4-5-12)9(8)11;1-2;/h2-3H,4H2,1H3;;/q;-1;+1.
What are the key properties of sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide?
sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide has a molecular weight of 293.07 g/mol, XLogP of -0.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-(6-bromo-2-fluoro-3-methoxyphenyl)acetonitrile;cyanide is sourced from PubChem (CID 175978714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).