About 2-(5-bromo-2,3-difluorophenyl)acetonitrile
2-(5-bromo-2,3-difluorophenyl)acetonitrile (PubChem CID 84795160) has the molecular formula C8H4BrF2N
and a molecular weight of 232.03 g/mol. Its IUPAC name is 2-(5-bromo-2,3-difluorophenyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(5-bromo-2,3-difluorophenyl)acetonitrile |
| PubChem CID | 84795160 |
| Molecular Formula | C8H4BrF2N |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 2-(5-bromo-2,3-difluorophenyl)acetonitrile |
| SMILES | N#CCc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C8H4BrF2N/c9-6-3-5(1-2-12)8(11)7(10)4-6/h3-4H,1H2 |
| InChIKey | SSZKSKWNLJSZDS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-bromo-2,3-difluorophenyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-2,3-difluorophenyl)acetonitrile?
The IUPAC name of 2-(5-bromo-2,3-difluorophenyl)acetonitrile (CID 84795160) is 2-(5-bromo-2,3-difluorophenyl)acetonitrile.
What is the SMILES notation for 2-(5-bromo-2,3-difluorophenyl)acetonitrile?
The canonical SMILES for 2-(5-bromo-2,3-difluorophenyl)acetonitrile is N#CCc1cc(Br)cc(F)c1F.
What is the InChIKey of 2-(5-bromo-2,3-difluorophenyl)acetonitrile?
The InChIKey is SSZKSKWNLJSZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrF2N/c9-6-3-5(1-2-12)8(11)7(10)4-6/h3-4H,1H2.
What are the key properties of 2-(5-bromo-2,3-difluorophenyl)acetonitrile?
2-(5-bromo-2,3-difluorophenyl)acetonitrile has a molecular weight of 232.03 g/mol, XLogP of 2.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-2,3-difluorophenyl)acetonitrile is sourced from PubChem (CID 84795160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).