C8H5F2NO — CID 118815281
2-(2,3-difluoro-5-hydroxyphenyl)acetonitrile (PubChem CID 118815281) has the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. Its IUPAC name is 2-(2,3-difluoro-5-hydroxyphenyl)acetonitrile.
| Compound Name | 2-(2,3-difluoro-5-hydroxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 118815281 |
| Molecular Formula | C8H5F2NO |
| Molecular Weight | 169.13 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2-(2,3-difluoro-5-hydroxyphenyl)acetonitrile |
| SMILES | N#CCc1cc(O)cc(F)c1F |
| InChI | InChI=1S/C8H5F2NO/c9-7-4-6(12)3-5(1-2-11)8(7)10/h3-4,12H,1H2 |
| InChIKey | LSISQUDJJLUZLL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |