C8H5BrFNO2 — CID 84802980
2-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)acetonitrile (PubChem CID 84802980) has the molecular formula C8H5BrFNO2 and a molecular weight of 246.03 g/mol. Its IUPAC name is 2-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)acetonitrile.
| Compound Name | 2-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 84802980 |
| Molecular Formula | C8H5BrFNO2 |
| Molecular Weight | 246.03 g/mol |
| Exact Mass | 244.95 |
| IUPAC Name | 2-(5-bromo-4-fluoro-2,3-dihydroxyphenyl)acetonitrile |
| SMILES | N#CCc1cc(Br)c(F)c(O)c1O |
| InChI | InChI=1S/C8H5BrFNO2/c9-5-3-4(1-2-11)7(12)8(13)6(5)10/h3,12-13H,1H2 |
| InChIKey | FFGHPZWMFKVUHF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.03 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|