About 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile
2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile (PubChem CID 84800270) has the molecular formula C10H10BrNO
and a molecular weight of 240.10 g/mol. Its IUPAC name is 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile |
| PubChem CID | 84800270 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile |
| SMILES | Cc1cc(CC#N)c(O)c(Br)c1C |
| InChI | InChI=1S/C10H10BrNO/c1-6-5-8(3-4-12)10(13)9(11)7(6)2/h5,13H,3H2,1-2H3 |
| InChIKey | RCUSCHILGOHWGU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile?
The IUPAC name of 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile (CID 84800270) is 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile.
What is the SMILES notation for 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile?
The canonical SMILES for 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile is Cc1cc(CC#N)c(O)c(Br)c1C.
What is the InChIKey of 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile?
The InChIKey is RCUSCHILGOHWGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO/c1-6-5-8(3-4-12)10(13)9(11)7(6)2/h5,13H,3H2,1-2H3.
What are the key properties of 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile?
2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile has a molecular weight of 240.10 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-2-hydroxy-4,5-dimethylphenyl)acetonitrile is sourced from PubChem (CID 84800270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).