C9H9NO2 — CID 84764573
2-(2,4-dihydroxy-3-methylphenyl)acetonitrile (PubChem CID 84764573) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-(2,4-dihydroxy-3-methylphenyl)acetonitrile.
| Compound Name | 2-(2,4-dihydroxy-3-methylphenyl)acetonitrile |
|---|---|
| PubChem CID | 84764573 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-(2,4-dihydroxy-3-methylphenyl)acetonitrile |
| SMILES | Cc1c(O)ccc(CC#N)c1O |
| InChI | InChI=1S/C9H9NO2/c1-6-8(11)3-2-7(4-5-10)9(6)12/h2-3,11-12H,4H2,1H3 |
| InChIKey | VZSIARNXMZLVFM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |