C10H7NO2S — CID 130792303
2-(3,4-dihydroxy-1-benzothiophen-7-yl)acetonitrile (PubChem CID 130792303) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-(3,4-dihydroxy-1-benzothiophen-7-yl)acetonitrile.
| Compound Name | 2-(3,4-dihydroxy-1-benzothiophen-7-yl)acetonitrile |
|---|---|
| PubChem CID | 130792303 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 2-(3,4-dihydroxy-1-benzothiophen-7-yl)acetonitrile |
| SMILES | N#CCc1ccc(O)c2c(O)csc12 |
| InChI | InChI=1S/C10H7NO2S/c11-4-3-6-1-2-7(12)9-8(13)5-14-10(6)9/h1-2,5,12-13H,3H2 |
| InChIKey | HYLABSRCKVFTFB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|