C9H8O3S — CID 130803250
7-(hydroxymethyl)-1-benzothiophene-3,4-diol (PubChem CID 130803250) has the molecular formula C9H8O3S and a molecular weight of 196.23 g/mol. Its IUPAC name is 7-(hydroxymethyl)-1-benzothiophene-3,4-diol.
| Compound Name | 7-(hydroxymethyl)-1-benzothiophene-3,4-diol |
|---|---|
| PubChem CID | 130803250 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 7-(hydroxymethyl)-1-benzothiophene-3,4-diol |
| SMILES | OCc1ccc(O)c2c(O)csc12 |
| InChI | InChI=1S/C9H8O3S/c10-3-5-1-2-6(11)8-7(12)4-13-9(5)8/h1-2,4,10-12H,3H2 |
| InChIKey | YVMZYWBSTIGILQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|