C10H5F2NS — CID 131053864
2-(3,7-difluoro-1-benzothiophen-6-yl)acetonitrile (PubChem CID 131053864) has the molecular formula C10H5F2NS and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-(3,7-difluoro-1-benzothiophen-6-yl)acetonitrile.
| Compound Name | 2-(3,7-difluoro-1-benzothiophen-6-yl)acetonitrile |
|---|---|
| PubChem CID | 131053864 |
| Molecular Formula | C10H5F2NS |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 2-(3,7-difluoro-1-benzothiophen-6-yl)acetonitrile |
| SMILES | N#CCc1ccc2c(F)csc2c1F |
| InChI | InChI=1S/C10H5F2NS/c11-8-5-14-10-7(8)2-1-6(3-4-13)9(10)12/h1-2,5H,3H2 |
| InChIKey | KOERUBJINKLTHF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |