C10H5Cl2NS — CID 130883941
2-(6,7-dichloro-1-benzothiophen-3-yl)acetonitrile (PubChem CID 130883941) has the molecular formula C10H5Cl2NS and a molecular weight of 242.13 g/mol. Its IUPAC name is 2-(6,7-dichloro-1-benzothiophen-3-yl)acetonitrile.
| Compound Name | 2-(6,7-dichloro-1-benzothiophen-3-yl)acetonitrile |
|---|---|
| PubChem CID | 130883941 |
| Molecular Formula | C10H5Cl2NS |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 240.95 |
| IUPAC Name | 2-(6,7-dichloro-1-benzothiophen-3-yl)acetonitrile |
| SMILES | N#CCc1csc2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C10H5Cl2NS/c11-8-2-1-7-6(3-4-13)5-14-10(7)9(8)12/h1-2,5H,3H2 |
| InChIKey | ZBRYJVJFRIQROO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |