C14H7Cl4N — CID 134630550
2-[3-chloro-2-(2,3,6-trichlorophenyl)phenyl]acetonitrile (PubChem CID 134630550) has the molecular formula C14H7Cl4N and a molecular weight of 331.03 g/mol. Its IUPAC name is 2-[3-chloro-2-(2,3,6-trichlorophenyl)phenyl]acetonitrile.
| Compound Name | 2-[3-chloro-2-(2,3,6-trichlorophenyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 134630550 |
| Molecular Formula | C14H7Cl4N |
| Molecular Weight | 331.03 g/mol |
| Exact Mass | 328.93 |
| IUPAC Name | 2-[3-chloro-2-(2,3,6-trichlorophenyl)phenyl]acetonitrile |
| SMILES | N#CCc1cccc(Cl)c1-c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H7Cl4N/c15-9-3-1-2-8(6-7-19)12(9)13-10(16)4-5-11(17)14(13)18/h1-5H,6H2 |
| InChIKey | WUZOHTSADDBBCA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.03 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|