C12H8Cl2N2S — CID 169438171
2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetonitrile (PubChem CID 169438171) has the molecular formula C12H8Cl2N2S and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetonitrile.
| Compound Name | 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetonitrile |
|---|---|
| PubChem CID | 169438171 |
| Molecular Formula | C12H8Cl2N2S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetonitrile |
| SMILES | N#[13C]Cc1cscc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H8Cl2N2S/c13-9-2-1-3-10(14)12(9)16-11-7-17-6-8(11)4-5-15/h1-3,6-7,16H,4H2/i5+1 |
| InChIKey | CPSPZBZRRLXMSY-HOSYLAQJSA-N |
| XLogP | 4.86 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |