C14H11Cl2NO2 — CID 88975698
[2-(2,6-dichloroanilino)phenyl]methyl formate (PubChem CID 88975698) has the molecular formula C14H11Cl2NO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is [2-(2,6-dichloroanilino)phenyl]methyl formate.
| Compound Name | [2-(2,6-dichloroanilino)phenyl]methyl formate |
|---|---|
| PubChem CID | 88975698 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | [2-(2,6-dichloroanilino)phenyl]methyl formate |
| SMILES | O=COCc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2NO2/c15-11-5-3-6-12(16)14(11)17-13-7-2-1-4-10(13)8-19-9-18/h1-7,9,17H,8H2 |
| InChIKey | KRWTXTHYTGBFAM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|