C22H19Cl2NO3 — CID 174584948
methyl 2-[3-[[2-(2,6-dichloroanilino)phenyl]methoxy]phenyl]acetate (PubChem CID 174584948) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is methyl 2-[3-[[2-(2,6-dichloroanilino)phenyl]methoxy]phenyl]acetate.
| Compound Name | methyl 2-[3-[[2-(2,6-dichloroanilino)phenyl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 174584948 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | methyl 2-[3-[[2-(2,6-dichloroanilino)phenyl]methoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(OCc2ccccc2Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C22H19Cl2NO3/c1-27-21(26)13-15-6-4-8-17(12-15)28-14-16-7-2-3-11-20(16)25-22-18(23)9-5-10-19(22)24/h2-12,25H,13-14H2,1H3 |
| InChIKey | NCBUWUHFYKUNRI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |