About 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver
2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver (PubChem CID 171593274) has the molecular formula C14H10AgCl2NO2-
and a molecular weight of 403.01 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver.
Molecular Properties
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver |
| PubChem CID | 171593274 |
| Molecular Formula | C14H10AgCl2NO2- |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver |
| SMILES | O=[Ag].O=[C-]Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H10Cl2NO.Ag.O/c15-11-5-3-6-12(16)14(11)17-13-7-2-1-4-10(13)8-9-18;;/h1-7,17H,8H2;;/q-1;; |
| InChIKey | SRBSHIVURYRENF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver?
The IUPAC name of 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver (CID 171593274) is 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver.
What is the SMILES notation for 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver?
The canonical SMILES for 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver is O=[Ag].O=[C-]Cc1ccccc1Nc1c(Cl)cccc1Cl.
What is the InChIKey of 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver?
The InChIKey is SRBSHIVURYRENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2NO.Ag.O/c15-11-5-3-6-12(16)14(11)17-13-7-2-1-4-10(13)8-9-18;;/h1-7,17H,8H2;;/q-1;;.
What are the key properties of 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver?
2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver has a molecular weight of 403.01 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver is sourced from PubChem (CID 171593274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).