C14H10AgCl2NO2- — CID 171593274
2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver (PubChem CID 171593274) has the molecular formula C14H10AgCl2NO2- and a molecular weight of 403.01 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver.
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver |
|---|---|
| PubChem CID | 171593274 |
| Molecular Formula | C14H10AgCl2NO2- |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 400.91 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]ethanone;oxosilver |
| SMILES | O=[Ag].O=[C-]Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H10Cl2NO.Ag.O/c15-11-5-3-6-12(16)14(11)17-13-7-2-1-4-10(13)8-9-18;;/h1-7,17H,8H2;;/q-1;; |
| InChIKey | SRBSHIVURYRENF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|