C20H23Cl2N2O+ — CID 20575581
2-[2-(2,6-dichloroanilino)phenyl]-1-(1-methylpiperidin-1-ium-1-yl)ethanone (PubChem CID 20575581) has the molecular formula C20H23Cl2N2O+ and a molecular weight of 378.32 g/mol. Its IUPAC name is 2-[2-(2,6-dichloroanilino)phenyl]-1-(1-methylpiperidin-1-ium-1-yl)ethanone.
| Compound Name | 2-[2-(2,6-dichloroanilino)phenyl]-1-(1-methylpiperidin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 20575581 |
| Molecular Formula | C20H23Cl2N2O+ |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[2-(2,6-dichloroanilino)phenyl]-1-(1-methylpiperidin-1-ium-1-yl)ethanone |
| SMILES | C[N+]1(C(=O)Cc2ccccc2Nc2c(Cl)cccc2Cl)CCCCC1 |
| InChI | InChI=1S/C20H23Cl2N2O/c1-24(12-5-2-6-13-24)19(25)14-15-8-3-4-11-18(15)23-20-16(21)9-7-10-17(20)22/h3-4,7-11,23H,2,5-6,12-14H2,1H3/q+1 |
| InChIKey | GVEPTBSWRLAWGH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|