C19H15Cl2NO2S — CID 57287670
benzyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate (PubChem CID 57287670) has the molecular formula C19H15Cl2NO2S and a molecular weight of 392.31 g/mol. Its IUPAC name is benzyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate.
| Compound Name | benzyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 57287670 |
| Molecular Formula | C19H15Cl2NO2S |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | benzyl 2-[4-(2,6-dichloroanilino)thiophen-3-yl]acetate |
| SMILES | O=C(Cc1cscc1Nc1c(Cl)cccc1Cl)OCc1ccccc1 |
| InChI | InChI=1S/C19H15Cl2NO2S/c20-15-7-4-8-16(21)19(15)22-17-12-25-11-14(17)9-18(23)24-10-13-5-2-1-3-6-13/h1-8,11-12,22H,9-10H2 |
| InChIKey | JYADZDKHJPTGCX-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |