C64H54Cl4O8 — CID 87352521
[3-[1,4,4-tris[3-[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]butyl]phenyl]methyl 2-(2-chlorophenyl)acetate (PubChem CID 87352521) has the molecular formula C64H54Cl4O8 and a molecular weight of 1092.94 g/mol. Its IUPAC name is [3-[1,4,4-tris[3-[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]butyl]phenyl]methyl 2-(2-chlorophenyl)acetate.
| Compound Name | [3-[1,4,4-tris[3-[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]butyl]phenyl]methyl 2-(2-chlorophenyl)acetate |
|---|---|
| PubChem CID | 87352521 |
| Molecular Formula | C64H54Cl4O8 |
| Molecular Weight | 1092.94 g/mol |
| Exact Mass | 1090.26 |
| IUPAC Name | [3-[1,4,4-tris[3-[[2-(2-chlorophenyl)acetyl]oxymethyl]phenyl]butyl]phenyl]methyl 2-(2-chlorophenyl)acetate |
| SMILES | O=C(Cc1ccccc1Cl)OCc1cccc(C(CCC(c2cccc(COC(=O)Cc3ccccc3Cl)c2)c2cccc(COC(=O)Cc3ccccc3Cl)c2)c2cccc(COC(=O)Cc3ccccc3Cl)c2)c1 |
| InChI | InChI=1S/C64H54Cl4O8/c65-57-25-5-1-17-51(57)35-61(69)73-39-43-13-9-21-47(31-43)55(48-22-10-14-44(32-48)40-74-62(70)36-52-18-2-6-26-58(52)66)29-30-56(49-23-11-15-45(33-49)41-75-63(71)37-53-19-3-7-27-59(53)67)50-24-12-16-46(34-50)42-76-64(72)38-54-20-4-8-28-60(54)68/h1-28,31-34,55-56H,29-30,35-42H2 |
| InChIKey | QGRYFNTZRXGCQG-UHFFFAOYSA-N |
| XLogP | 15.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.94 |
| LogP ≤ 5 | 15.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|